C17H20N4O4S3 — CID 55763498
N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 55763498) has the molecular formula C17H20N4O4S3 and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 55763498 |
| Molecular Formula | C17H20N4O4S3 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2csc(NC(=O)CCN3CCSC3=O)n2)cc1 |
| InChI | InChI=1S/C17H20N4O4S3/c1-20(2)28(24,25)13-5-3-12(4-6-13)14-11-27-16(18-14)19-15(22)7-8-21-9-10-26-17(21)23/h3-6,11H,7-10H2,1-2H3,(H,18,19,22) |
| InChIKey | QJFRLHRQUJUGOM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|