C15H24N4O3S — CID 1439115
N-[4-(dimethylsulfamoyl)phenyl]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 1439115) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 1439115 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(CC(=O)Nc2ccc(S(=O)(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C15H24N4O3S/c1-17(2)23(21,22)14-6-4-13(5-7-14)16-15(20)12-19-10-8-18(3)9-11-19/h4-7H,8-12H2,1-3H3,(H,16,20) |
| InChIKey | RUMMOUYKYIIWNG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |