C18H29N3O3S2 — CID 134064419
2-[2-(azepan-1-yl)ethylsulfanyl]-N-[4-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 134064419) has the molecular formula C18H29N3O3S2 and a molecular weight of 399.58 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)ethylsulfanyl]-N-[4-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-[4-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 134064419 |
| Molecular Formula | C18H29N3O3S2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-[4-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)CSCCN2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H29N3O3S2/c1-20(2)26(23,24)17-9-7-16(8-10-17)19-18(22)15-25-14-13-21-11-5-3-4-6-12-21/h7-10H,3-6,11-15H2,1-2H3,(H,19,22) |
| InChIKey | FBLQRKKVGXQQFN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|