C16H24N2O2S — CID 134064908
2-[2-(azepan-1-yl)ethylsulfanyl]-N-(2-hydroxyphenyl)acetamide (PubChem CID 134064908) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)ethylsulfanyl]-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 134064908 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-(2-hydroxyphenyl)acetamide |
| SMILES | O=C(CSCCN1CCCCCC1)Nc1ccccc1O |
| InChI | InChI=1S/C16H24N2O2S/c19-15-8-4-3-7-14(15)17-16(20)13-21-12-11-18-9-5-1-2-6-10-18/h3-4,7-8,19H,1-2,5-6,9-13H2,(H,17,20) |
| InChIKey | OLPJGAHJUZNVOK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|