C20H30ClN3O2S — CID 134064781
2-[2-(azepan-1-yl)ethylsulfanyl]-N-(5-chloro-2-morpholin-4-ylphenyl)acetamide (PubChem CID 134064781) has the molecular formula C20H30ClN3O2S and a molecular weight of 412.00 g/mol. Its IUPAC name is 2-[2-(azepan-1-yl)ethylsulfanyl]-N-(5-chloro-2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-(5-chloro-2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 134064781 |
| Molecular Formula | C20H30ClN3O2S |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[2-(azepan-1-yl)ethylsulfanyl]-N-(5-chloro-2-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CSCCN1CCCCCC1)Nc1cc(Cl)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H30ClN3O2S/c21-17-5-6-19(24-9-12-26-13-10-24)18(15-17)22-20(25)16-27-14-11-23-7-3-1-2-4-8-23/h5-6,15H,1-4,7-14,16H2,(H,22,25) |
| InChIKey | VHXWVNLNPCFNIX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|