C13H17ClN4O3 — CID 16777669
(3Z)-3-amino-N-(5-chloro-2-morpholin-4-ylphenyl)-3-hydroxyiminopropanamide (PubChem CID 16777669) has the molecular formula C13H17ClN4O3 and a molecular weight of 312.76 g/mol. Its IUPAC name is (3Z)-3-amino-N-(5-chloro-2-morpholin-4-ylphenyl)-3-hydroxyiminopropanamide.
| Compound Name | (3Z)-3-amino-N-(5-chloro-2-morpholin-4-ylphenyl)-3-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 16777669 |
| Molecular Formula | C13H17ClN4O3 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (3Z)-3-amino-N-(5-chloro-2-morpholin-4-ylphenyl)-3-hydroxyiminopropanamide |
| SMILES | N/C(CC(=O)Nc1cc(Cl)ccc1N1CCOCC1)=N\O |
| InChI | InChI=1S/C13H17ClN4O3/c14-9-1-2-11(18-3-5-21-6-4-18)10(7-9)16-13(19)8-12(15)17-20/h1-2,7,20H,3-6,8H2,(H2,15,17)(H,16,19) |
| InChIKey | JDAKFNSKKJFEQY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|