C17H18N2O3S — CID 51284419
2-[2-(2-hydroxyanilino)-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide (PubChem CID 51284419) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[2-(2-hydroxyanilino)-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-(2-hydroxyanilino)-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 51284419 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[2-(2-hydroxyanilino)-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CSCC(=O)Nc2ccccc2O)c1 |
| InChI | InChI=1S/C17H18N2O3S/c1-12-5-4-6-13(9-12)18-16(21)10-23-11-17(22)19-14-7-2-3-8-15(14)20/h2-9,20H,10-11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | XHSLAKDYMYFUGN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|