C24H23N3O2S — CID 41375162
2-[2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide (PubChem CID 41375162) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-[2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 41375162 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[2-(2-benzhydrylidenehydrazinyl)-2-oxoethyl]sulfanyl-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CSCC(=O)NN=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23N3O2S/c1-18-9-8-14-21(15-18)25-22(28)16-30-17-23(29)26-27-24(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-15H,16-17H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | XOZSGGJGTHILND-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|