C13H19N3O4S — CID 2082690
3-acetamido-N-[4-(dimethylsulfamoyl)phenyl]propanamide (PubChem CID 2082690) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-acetamido-N-[4-(dimethylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-acetamido-N-[4-(dimethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 2082690 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-acetamido-N-[4-(dimethylsulfamoyl)phenyl]propanamide |
| SMILES | CC(=O)NCCC(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C13H19N3O4S/c1-10(17)14-9-8-13(18)15-11-4-6-12(7-5-11)21(19,20)16(2)3/h4-7H,8-9H2,1-3H3,(H,14,17)(H,15,18) |
| InChIKey | RPCCGLQPCYEGEI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |