C16H27N4O4S+ — CID 9289313
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium (PubChem CID 9289313) has the molecular formula C16H27N4O4S+ and a molecular weight of 371.48 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9289313 |
| Molecular Formula | C16H27N4O4S+ |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
| SMILES | CCCNC(=O)C[NH+](C)CC(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C16H26N4O4S/c1-5-10-17-15(21)11-20(4)12-16(22)18-13-6-8-14(9-7-13)25(23,24)19(2)3/h6-9H,5,10-12H2,1-4H3,(H,17,21)(H,18,22)/p+1 |
| InChIKey | ZKSYEKUXGRRQIX-UHFFFAOYSA-O |
| XLogP | -1.08 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |