C14H26N4O3S+2 — CID 8000284
2-[[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]azaniumyl]ethyl-dimethylazanium (PubChem CID 8000284) has the molecular formula C14H26N4O3S+2 and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-[[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]azaniumyl]ethyl-dimethylazanium.
| Compound Name | 2-[[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]azaniumyl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8000284 |
| Molecular Formula | C14H26N4O3S+2 |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-[[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]azaniumyl]ethyl-dimethylazanium |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)C[NH2+]CC[NH+](C)C)cc1 |
| InChI | InChI=1S/C14H24N4O3S/c1-17(2)10-9-15-11-14(19)16-12-5-7-13(8-6-12)22(20,21)18(3)4/h5-8,15H,9-11H2,1-4H3,(H,16,19)/p+2 |
| InChIKey | DEMQKOYPVWBKGZ-UHFFFAOYSA-P |
| XLogP | -2.42 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|