C16H22N3O4S+ — CID 8919420
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8919420) has the molecular formula C16H22N3O4S+ and a molecular weight of 352.44 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8919420 |
| Molecular Formula | C16H22N3O4S+ |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1)c1ccco1 |
| InChI | InChI=1S/C16H21N3O4S/c1-12(15-5-4-10-23-15)17-11-16(20)18-13-6-8-14(9-7-13)24(21,22)19(2)3/h4-10,12,17H,11H2,1-3H3,(H,18,20)/p+1/t12-/m0/s1 |
| InChIKey | NLYSCLJIPOAWCP-LBPRGKRZSA-O |
| XLogP | 0.79 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |