C15H19N2O3+ — CID 8918132
[(1R)-1-(furan-2-yl)ethyl]-[2-(4-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 8918132) has the molecular formula C15H19N2O3+ and a molecular weight of 275.33 g/mol. Its IUPAC name is [(1R)-1-(furan-2-yl)ethyl]-[2-(4-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(furan-2-yl)ethyl]-[2-(4-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8918132 |
| Molecular Formula | C15H19N2O3+ |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | [(1R)-1-(furan-2-yl)ethyl]-[2-(4-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | COc1ccc(NC(=O)C[NH2+][C@H](C)c2ccco2)cc1 |
| InChI | InChI=1S/C15H18N2O3/c1-11(14-4-3-9-20-14)16-10-15(18)17-12-5-7-13(19-2)8-6-12/h3-9,11,16H,10H2,1-2H3,(H,17,18)/p+1/t11-/m1/s1 |
| InChIKey | YDHMMWJDMJTHJX-LLVKDONJSA-O |
| XLogP | 1.55 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |