C14H16ClN2O2+ — CID 8917842
[2-(3-chloroanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8917842) has the molecular formula C14H16ClN2O2+ and a molecular weight of 279.75 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8917842 |
| Molecular Formula | C14H16ClN2O2+ |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1cccc(Cl)c1)c1ccco1 |
| InChI | InChI=1S/C14H15ClN2O2/c1-10(13-6-3-7-19-13)16-9-14(18)17-12-5-2-4-11(15)8-12/h2-8,10,16H,9H2,1H3,(H,17,18)/p+1/t10-/m1/s1 |
| InChIKey | WVJJYLVRKOTDHR-SNVBAGLBSA-O |
| XLogP | 2.20 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |