C14H15Cl2N2O2+ — CID 8918435
[2-(2,3-dichloroanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8918435) has the molecular formula C14H15Cl2N2O2+ and a molecular weight of 314.19 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8918435 |
| Molecular Formula | C14H15Cl2N2O2+ |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1cccc(Cl)c1Cl)c1ccco1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-9(12-6-3-7-20-12)17-8-13(19)18-11-5-2-4-10(15)14(11)16/h2-7,9,17H,8H2,1H3,(H,18,19)/p+1/t9-/m1/s1 |
| InChIKey | OEFDNYMNSMRVHF-SECBINFHSA-O |
| XLogP | 2.85 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |