C13H15ClN3O2+ — CID 8919194
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8919194) has the molecular formula C13H15ClN3O2+ and a molecular weight of 280.74 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8919194 |
| Molecular Formula | C13H15ClN3O2+ |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1cccnc1Cl)c1ccco1 |
| InChI | InChI=1S/C13H14ClN3O2/c1-9(11-5-3-7-19-11)16-8-12(18)17-10-4-2-6-15-13(10)14/h2-7,9,16H,8H2,1H3,(H,17,18)/p+1/t9-/m0/s1 |
| InChIKey | RFHUWFKSFAKVLQ-VIFPVBQESA-O |
| XLogP | 1.59 |
| TPSA | 71.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|