C16H18BrClN3O+ — CID 8710771
[(1R)-1-(4-bromophenyl)propyl]-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]azanium (PubChem CID 8710771) has the molecular formula C16H18BrClN3O+ and a molecular weight of 383.70 g/mol. Its IUPAC name is [(1R)-1-(4-bromophenyl)propyl]-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]azanium.
| Compound Name | [(1R)-1-(4-bromophenyl)propyl]-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8710771 |
| Molecular Formula | C16H18BrClN3O+ |
| Molecular Weight | 383.70 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | [(1R)-1-(4-bromophenyl)propyl]-[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]azanium |
| SMILES | CC[C@@H]([NH2+]CC(=O)Nc1cccnc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H17BrClN3O/c1-2-13(11-5-7-12(17)8-6-11)20-10-15(22)21-14-4-3-9-19-16(14)18/h3-9,13,20H,2,10H2,1H3,(H,21,22)/p+1/t13-/m1/s1 |
| InChIKey | JJIKZFGZJDMLBN-CYBMUJFWSA-O |
| XLogP | 3.15 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.70 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|