C17H17BrF3N2O+ — CID 9263642
[(1R)-1-(4-bromophenyl)propyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 9263642) has the molecular formula C17H17BrF3N2O+ and a molecular weight of 402.23 g/mol. Its IUPAC name is [(1R)-1-(4-bromophenyl)propyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [(1R)-1-(4-bromophenyl)propyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9263642 |
| Molecular Formula | C17H17BrF3N2O+ |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | [(1R)-1-(4-bromophenyl)propyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | CC[C@@H]([NH2+]CC(=O)Nc1ccc(F)c(F)c1F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrF3N2O/c1-2-13(10-3-5-11(18)6-4-10)22-9-15(24)23-14-8-7-12(19)16(20)17(14)21/h3-8,13,22H,2,9H2,1H3,(H,23,24)/p+1/t13-/m1/s1 |
| InChIKey | PQYSRWDWSJDALL-CYBMUJFWSA-O |
| XLogP | 3.52 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|