C18H22BrN2OS+ — CID 9263737
[(1S)-1-(4-bromophenyl)propyl]-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium (PubChem CID 9263737) has the molecular formula C18H22BrN2OS+ and a molecular weight of 394.36 g/mol. Its IUPAC name is [(1S)-1-(4-bromophenyl)propyl]-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(4-bromophenyl)propyl]-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9263737 |
| Molecular Formula | C18H22BrN2OS+ |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | [(1S)-1-(4-bromophenyl)propyl]-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
| SMILES | CC[C@H]([NH2+]CC(=O)Nc1ccccc1SC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H21BrN2OS/c1-3-15(13-8-10-14(19)11-9-13)20-12-18(22)21-16-6-4-5-7-17(16)23-2/h4-11,15,20H,3,12H2,1-2H3,(H,21,22)/p+1/t15-/m0/s1 |
| InChIKey | UFIVJAHFIIPRQD-HNNXBMFYSA-O |
| XLogP | 3.82 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |