C16H25BrN3O2+ — CID 8643776
[(1S)-1-(4-bromophenyl)propyl]-[2-(butylcarbamoylamino)-2-oxoethyl]azanium (PubChem CID 8643776) has the molecular formula C16H25BrN3O2+ and a molecular weight of 371.30 g/mol. Its IUPAC name is [(1S)-1-(4-bromophenyl)propyl]-[2-(butylcarbamoylamino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(4-bromophenyl)propyl]-[2-(butylcarbamoylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8643776 |
| Molecular Formula | C16H25BrN3O2+ |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [(1S)-1-(4-bromophenyl)propyl]-[2-(butylcarbamoylamino)-2-oxoethyl]azanium |
| SMILES | CCCCNC(=O)NC(=O)C[NH2+][C@@H](CC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H24BrN3O2/c1-3-5-10-18-16(22)20-15(21)11-19-14(4-2)12-6-8-13(17)9-7-12/h6-9,14,19H,3-5,10-11H2,1-2H3,(H2,18,20,21,22)/p+1/t14-/m0/s1 |
| InChIKey | JTKIUXHARLJEIG-AWEZNQCLSA-O |
| XLogP | 2.09 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|