C21H26F2N3O3+ — CID 8830996
[2-(butylcarbamoylamino)-2-oxoethyl]-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]azanium (PubChem CID 8830996) has the molecular formula C21H26F2N3O3+ and a molecular weight of 406.45 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl]-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]azanium.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl]-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]azanium |
|---|---|
| PubChem CID | 8830996 |
| Molecular Formula | C21H26F2N3O3+ |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl]-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]azanium |
| SMILES | CCCCNC(=O)NC(=O)C[NH2+][C@@H](c1ccccc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H25F2N3O3/c1-2-3-13-24-21(28)26-18(27)14-25-19(15-7-5-4-6-8-15)16-9-11-17(12-10-16)29-20(22)23/h4-12,19-20,25H,2-3,13-14H2,1H3,(H2,24,26,27,28)/p+1/t19-/m0/s1 |
| InChIKey | QPJHTLSMDDVOJS-IBGZPJMESA-O |
| XLogP | 2.57 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|