C16H26N3O2+ — CID 9132326
[(1R)-2-methyl-1-phenylpropyl]-[2-oxo-2-(propylcarbamoylamino)ethyl]azanium (PubChem CID 9132326) has the molecular formula C16H26N3O2+ and a molecular weight of 292.40 g/mol. Its IUPAC name is [(1R)-2-methyl-1-phenylpropyl]-[2-oxo-2-(propylcarbamoylamino)ethyl]azanium.
| Compound Name | [(1R)-2-methyl-1-phenylpropyl]-[2-oxo-2-(propylcarbamoylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9132326 |
| Molecular Formula | C16H26N3O2+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [(1R)-2-methyl-1-phenylpropyl]-[2-oxo-2-(propylcarbamoylamino)ethyl]azanium |
| SMILES | CCCNC(=O)NC(=O)C[NH2+][C@@H](c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H25N3O2/c1-4-10-17-16(21)19-14(20)11-18-15(12(2)3)13-8-6-5-7-9-13/h5-9,12,15,18H,4,10-11H2,1-3H3,(H2,17,19,20,21)/p+1/t15-/m1/s1 |
| InChIKey | GWIFIQDZCFGLRB-OAHLLOKOSA-O |
| XLogP | 1.18 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |