C17H28N3O2+ — CID 9132137
[2-(tert-butylcarbamoylamino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium (PubChem CID 9132137) has the molecular formula C17H28N3O2+ and a molecular weight of 306.43 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium |
|---|---|
| PubChem CID | 9132137 |
| Molecular Formula | C17H28N3O2+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+]CC(=O)NC(=O)NC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H27N3O2/c1-12(2)15(13-9-7-6-8-10-13)18-11-14(21)19-16(22)20-17(3,4)5/h6-10,12,15,18H,11H2,1-5H3,(H2,19,20,21,22)/p+1/t15-/m1/s1 |
| InChIKey | AXRMHFFRVMWQGF-OAHLLOKOSA-O |
| XLogP | 1.57 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |