C20H27N2O+ — CID 9131705
[(1R)-2-methyl-1-phenylpropyl]-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]azanium (PubChem CID 9131705) has the molecular formula C20H27N2O+ and a molecular weight of 311.45 g/mol. Its IUPAC name is [(1R)-2-methyl-1-phenylpropyl]-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]azanium.
| Compound Name | [(1R)-2-methyl-1-phenylpropyl]-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 9131705 |
| Molecular Formula | C20H27N2O+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | [(1R)-2-methyl-1-phenylpropyl]-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+]CC(=O)N[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-15(2)20(18-12-8-5-9-13-18)21-14-19(23)22-16(3)17-10-6-4-7-11-17/h4-13,15-16,20-21H,14H2,1-3H3,(H,22,23)/p+1/t16-,20+/m0/s1 |
| InChIKey | GOZJJEWVYNJHMA-OXJNMPFZSA-O |
| XLogP | 2.82 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |