C20H25N2O2+ — CID 9132063
[2-(2-acetylanilino)-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium (PubChem CID 9132063) has the molecular formula C20H25N2O2+ and a molecular weight of 325.43 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium |
|---|---|
| PubChem CID | 9132063 |
| Molecular Formula | C20H25N2O2+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium |
| SMILES | CC(=O)c1ccccc1NC(=O)C[NH2+][C@H](c1ccccc1)C(C)C |
| InChI | InChI=1S/C20H24N2O2/c1-14(2)20(16-9-5-4-6-10-16)21-13-19(24)22-18-12-8-7-11-17(18)15(3)23/h4-12,14,20-21H,13H2,1-3H3,(H,22,24)/p+1/t20-/m0/s1 |
| InChIKey | BXYQENFQOCYEKI-FQEVSTJZSA-O |
| XLogP | 2.79 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |