C18H21Cl2N2O+ — CID 9131604
[2-(2,5-dichloroanilino)-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium (PubChem CID 9131604) has the molecular formula C18H21Cl2N2O+ and a molecular weight of 352.29 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium |
|---|---|
| PubChem CID | 9131604 |
| Molecular Formula | C18H21Cl2N2O+ |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl]-[(1S)-2-methyl-1-phenylpropyl]azanium |
| SMILES | CC(C)[C@H]([NH2+]CC(=O)Nc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C18H20Cl2N2O/c1-12(2)18(13-6-4-3-5-7-13)21-11-17(23)22-16-10-14(19)8-9-15(16)20/h3-10,12,18,21H,11H2,1-2H3,(H,22,23)/p+1/t18-/m0/s1 |
| InChIKey | WWMPQBZCJTYGMY-SFHVURJKSA-O |
| XLogP | 3.89 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |