C19H25N2O2+ — CID 9131715
[2-(2-methoxyanilino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium (PubChem CID 9131715) has the molecular formula C19H25N2O2+ and a molecular weight of 313.42 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium |
|---|---|
| PubChem CID | 9131715 |
| Molecular Formula | C19H25N2O2+ |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl]-[(1R)-2-methyl-1-phenylpropyl]azanium |
| SMILES | COc1ccccc1NC(=O)C[NH2+][C@@H](c1ccccc1)C(C)C |
| InChI | InChI=1S/C19H24N2O2/c1-14(2)19(15-9-5-4-6-10-15)20-13-18(22)21-16-11-7-8-12-17(16)23-3/h4-12,14,19-20H,13H2,1-3H3,(H,21,22)/p+1/t19-/m1/s1 |
| InChIKey | XXRDUZYEYQOHEL-LJQANCHMSA-O |
| XLogP | 2.59 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |