C18H21BrFN2O+ — CID 9133558
[2-(2-bromoanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium (PubChem CID 9133558) has the molecular formula C18H21BrFN2O+ and a molecular weight of 380.28 g/mol. Its IUPAC name is [2-(2-bromoanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium.
| Compound Name | [2-(2-bromoanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 9133558 |
| Molecular Formula | C18H21BrFN2O+ |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [2-(2-bromoanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+]CC(=O)Nc1ccccc1Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20BrFN2O/c1-12(2)18(13-7-9-14(20)10-8-13)21-11-17(23)22-16-6-4-3-5-15(16)19/h3-10,12,18,21H,11H2,1-2H3,(H,22,23)/p+1/t18-/m1/s1 |
| InChIKey | JENWXJFGUMQBAR-GOSISDBHSA-O |
| XLogP | 3.49 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |