C19H20ClFN3O+ — CID 9133336
[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium (PubChem CID 9133336) has the molecular formula C19H20ClFN3O+ and a molecular weight of 360.84 g/mol. Its IUPAC name is [2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium.
| Compound Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 9133336 |
| Molecular Formula | C19H20ClFN3O+ |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+]CC(=O)Nc1cc(Cl)ccc1C#N)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19ClFN3O/c1-12(2)19(13-4-7-16(21)8-5-13)23-11-18(25)24-17-9-15(20)6-3-14(17)10-22/h3-9,12,19,23H,11H2,1-2H3,(H,24,25)/p+1/t19-/m1/s1 |
| InChIKey | ZDGRMJKRCOUEQS-LJQANCHMSA-O |
| XLogP | 3.25 |
| TPSA | 69.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |