C20H24FN2O2+ — CID 9133680
[2-(2-acetylanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium (PubChem CID 9133680) has the molecular formula C20H24FN2O2+ and a molecular weight of 343.42 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 9133680 |
| Molecular Formula | C20H24FN2O2+ |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
| SMILES | CC(=O)c1ccccc1NC(=O)C[NH2+][C@@H](c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C20H23FN2O2/c1-13(2)20(15-8-10-16(21)11-9-15)22-12-19(25)23-18-7-5-4-6-17(18)14(3)24/h4-11,13,20,22H,12H2,1-3H3,(H,23,25)/p+1/t20-/m1/s1 |
| InChIKey | XQARJZFOKWAYJI-HXUWFJFHSA-O |
| XLogP | 2.93 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |