C20H26FN2O2+ — CID 9133375
[2-(2-ethoxyanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium (PubChem CID 9133375) has the molecular formula C20H26FN2O2+ and a molecular weight of 345.44 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 9133375 |
| Molecular Formula | C20H26FN2O2+ |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl]-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
| SMILES | CCOc1ccccc1NC(=O)C[NH2+][C@@H](c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C20H25FN2O2/c1-4-25-18-8-6-5-7-17(18)23-19(24)13-22-20(14(2)3)15-9-11-16(21)12-10-15/h5-12,14,20,22H,4,13H2,1-3H3,(H,23,24)/p+1/t20-/m1/s1 |
| InChIKey | QJTKPHVIKFLVHY-HXUWFJFHSA-O |
| XLogP | 3.12 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |