C20H22ClN3O — CID 9028532
N-(5-chloro-2-cyanophenyl)-2-[methyl-[(4-propan-2-ylphenyl)methyl]amino]acetamide (PubChem CID 9028532) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is N-(5-chloro-2-cyanophenyl)-2-[methyl-[(4-propan-2-ylphenyl)methyl]amino]acetamide.
| Compound Name | N-(5-chloro-2-cyanophenyl)-2-[methyl-[(4-propan-2-ylphenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 9028532 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-(5-chloro-2-cyanophenyl)-2-[methyl-[(4-propan-2-ylphenyl)methyl]amino]acetamide |
| SMILES | CC(C)c1ccc(CN(C)CC(=O)Nc2cc(Cl)ccc2C#N)cc1 |
| InChI | InChI=1S/C20H22ClN3O/c1-14(2)16-6-4-15(5-7-16)12-24(3)13-20(25)23-19-10-18(21)9-8-17(19)11-22/h4-10,14H,12-13H2,1-3H3,(H,23,25) |
| InChIKey | GSKWOSFUAVYJOO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |