C17H21N2O2+ — CID 8898444
[2-(2-methoxyanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium (PubChem CID 8898444) has the molecular formula C17H21N2O2+ and a molecular weight of 285.37 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 8898444 |
| Molecular Formula | C17H21N2O2+ |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
| SMILES | COc1ccccc1NC(=O)C[NH2+][C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-13(14-8-4-3-5-9-14)18-12-17(20)19-15-10-6-7-11-16(15)21-2/h3-11,13,18H,12H2,1-2H3,(H,19,20)/p+1/t13-/m1/s1 |
| InChIKey | XFXLJOOVNTUPRU-CYBMUJFWSA-O |
| XLogP | 1.96 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |