C16H17F2N2O+ — CID 2684101
[2-(2,4-difluoroanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium (PubChem CID 2684101) has the molecular formula C16H17F2N2O+ and a molecular weight of 291.32 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 2684101 |
| Molecular Formula | C16H17F2N2O+ |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C16H16F2N2O/c1-11(12-5-3-2-4-6-12)19-10-16(21)20-15-8-7-13(17)9-14(15)18/h2-9,11,19H,10H2,1H3,(H,20,21)/p+1/t11-/m1/s1 |
| InChIKey | CFAGYCFMTKELHN-LLVKDONJSA-O |
| XLogP | 2.23 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |