C16H17ClN3O3+ — CID 8898627
[2-(2-chloro-4-nitroanilino)-2-oxoethyl]-[(1S)-1-phenylethyl]azanium (PubChem CID 8898627) has the molecular formula C16H17ClN3O3+ and a molecular weight of 334.78 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl]-[(1S)-1-phenylethyl]azanium.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl]-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 8898627 |
| Molecular Formula | C16H17ClN3O3+ |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl]-[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1ccc([N+](=O)[O-])cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H16ClN3O3/c1-11(12-5-3-2-4-6-12)18-10-16(21)19-15-8-7-13(20(22)23)9-14(15)17/h2-9,11,18H,10H2,1H3,(H,19,21)/p+1/t11-/m0/s1 |
| InChIKey | JRUPGCONNROUFJ-NSHDSACASA-O |
| XLogP | 2.51 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|