C19H23ClN3O3+ — CID 7958084
[(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl]-(3-methylbutyl)azanium (PubChem CID 7958084) has the molecular formula C19H23ClN3O3+ and a molecular weight of 376.86 g/mol. Its IUPAC name is [(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl]-(3-methylbutyl)azanium.
| Compound Name | [(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl]-(3-methylbutyl)azanium |
|---|---|
| PubChem CID | 7958084 |
| Molecular Formula | C19H23ClN3O3+ |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl]-(3-methylbutyl)azanium |
| SMILES | CC(C)CC[NH2+][C@H](C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-13(2)10-11-21-18(14-6-4-3-5-7-14)19(24)22-17-9-8-15(23(25)26)12-16(17)20/h3-9,12-13,18,21H,10-11H2,1-2H3,(H,22,24)/p+1/t18-/m0/s1 |
| InChIKey | ZFCLOARNTLLSSY-SFHVURJKSA-O |
| XLogP | 3.54 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|