C17H19ClN3O4+ — CID 9307131
[(1S)-1-(2-chlorophenyl)ethyl]-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]azanium (PubChem CID 9307131) has the molecular formula C17H19ClN3O4+ and a molecular weight of 364.81 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl]-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9307131 |
| Molecular Formula | C17H19ClN3O4+ |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]azanium |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C[NH2+][C@@H](C)c1ccccc1Cl |
| InChI | InChI=1S/C17H18ClN3O4/c1-11(13-5-3-4-6-14(13)18)19-10-17(22)20-15-8-7-12(21(23)24)9-16(15)25-2/h3-9,11,19H,10H2,1-2H3,(H,20,22)/p+1/t11-/m0/s1 |
| InChIKey | KACZBIJQIWSRKJ-NSHDSACASA-O |
| XLogP | 2.52 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|