C18H22ClN2O3+ — CID 9307194
[(1S)-1-(2-chlorophenyl)ethyl]-[2-(2,4-dimethoxyanilino)-2-oxoethyl]azanium (PubChem CID 9307194) has the molecular formula C18H22ClN2O3+ and a molecular weight of 349.84 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl]-[2-(2,4-dimethoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-(2,4-dimethoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9307194 |
| Molecular Formula | C18H22ClN2O3+ |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-(2,4-dimethoxyanilino)-2-oxoethyl]azanium |
| SMILES | COc1ccc(NC(=O)C[NH2+][C@@H](C)c2ccccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-12(14-6-4-5-7-15(14)19)20-11-18(22)21-16-9-8-13(23-2)10-17(16)24-3/h4-10,12,20H,11H2,1-3H3,(H,21,22)/p+1/t12-/m0/s1 |
| InChIKey | YEOCBFBGJOMQFD-LBPRGKRZSA-O |
| XLogP | 2.62 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |