C23H24ClN2O+ — CID 9307291
[2-(2-benzylanilino)-2-oxoethyl]-[(1R)-1-(2-chlorophenyl)ethyl]azanium (PubChem CID 9307291) has the molecular formula C23H24ClN2O+ and a molecular weight of 379.91 g/mol. Its IUPAC name is [2-(2-benzylanilino)-2-oxoethyl]-[(1R)-1-(2-chlorophenyl)ethyl]azanium.
| Compound Name | [2-(2-benzylanilino)-2-oxoethyl]-[(1R)-1-(2-chlorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9307291 |
| Molecular Formula | C23H24ClN2O+ |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [2-(2-benzylanilino)-2-oxoethyl]-[(1R)-1-(2-chlorophenyl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1ccccc1Cc1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C23H23ClN2O/c1-17(20-12-6-7-13-21(20)24)25-16-23(27)26-22-14-8-5-11-19(22)15-18-9-3-2-4-10-18/h2-14,17,25H,15-16H2,1H3,(H,26,27)/p+1/t17-/m1/s1 |
| InChIKey | XNJHFEDSHWPFJJ-QGZVFWFLSA-O |
| XLogP | 4.19 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |