C17H19ClFN2O+ — CID 8599138
[(1S)-1-(2-chlorophenyl)ethyl]-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]azanium (PubChem CID 8599138) has the molecular formula C17H19ClFN2O+ and a molecular weight of 321.80 g/mol. Its IUPAC name is [(1S)-1-(2-chlorophenyl)ethyl]-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]azanium.
| Compound Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8599138 |
| Molecular Formula | C17H19ClFN2O+ |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | [(1S)-1-(2-chlorophenyl)ethyl]-[2-[(2-fluorophenyl)methylamino]-2-oxoethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NCc1ccccc1F)c1ccccc1Cl |
| InChI | InChI=1S/C17H18ClFN2O/c1-12(14-7-3-4-8-15(14)18)20-11-17(22)21-10-13-6-2-5-9-16(13)19/h2-9,12,20H,10-11H2,1H3,(H,21,22)/p+1/t12-/m0/s1 |
| InChIKey | RKZHVMDDQCZIMO-LBPRGKRZSA-O |
| XLogP | 2.42 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |