C22H22ClN2O+ — CID 9307286
[(1R)-1-(2-chlorophenyl)ethyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium (PubChem CID 9307286) has the molecular formula C22H22ClN2O+ and a molecular weight of 365.88 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9307286 |
| Molecular Formula | C22H22ClN2O+ |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1ccccc1-c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C22H21ClN2O/c1-16(18-11-5-7-13-20(18)23)24-15-22(26)25-21-14-8-6-12-19(21)17-9-3-2-4-10-17/h2-14,16,24H,15H2,1H3,(H,25,26)/p+1/t16-/m1/s1 |
| InChIKey | QFYZPGRYQFDJAX-MRXNPFEDSA-O |
| XLogP | 4.27 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |