C22H21F2N2O+ — CID 9377059
[(1R)-1-(3,4-difluorophenyl)ethyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium (PubChem CID 9377059) has the molecular formula C22H21F2N2O+ and a molecular weight of 367.42 g/mol. Its IUPAC name is [(1R)-1-(3,4-difluorophenyl)ethyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium.
| Compound Name | [(1R)-1-(3,4-difluorophenyl)ethyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9377059 |
| Molecular Formula | C22H21F2N2O+ |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [(1R)-1-(3,4-difluorophenyl)ethyl]-[2-oxo-2-(2-phenylanilino)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1ccccc1-c1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H20F2N2O/c1-15(17-11-12-19(23)20(24)13-17)25-14-22(27)26-21-10-6-5-9-18(21)16-7-3-2-4-8-16/h2-13,15,25H,14H2,1H3,(H,26,27)/p+1/t15-/m1/s1 |
| InChIKey | SYQWCFOZVVIJKK-OAHLLOKOSA-O |
| XLogP | 3.89 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |