C17H18F2N3O2+ — CID 9375590
[2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1R)-1-(3,4-difluorophenyl)ethyl]azanium (PubChem CID 9375590) has the molecular formula C17H18F2N3O2+ and a molecular weight of 334.35 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1R)-1-(3,4-difluorophenyl)ethyl]azanium.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1R)-1-(3,4-difluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9375590 |
| Molecular Formula | C17H18F2N3O2+ |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1R)-1-(3,4-difluorophenyl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)NNC(=O)c1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H17F2N3O2/c1-11(13-7-8-14(18)15(19)9-13)20-10-16(23)21-22-17(24)12-5-3-2-4-6-12/h2-9,11,20H,10H2,1H3,(H,21,23)(H,22,24)/p+1/t11-/m1/s1 |
| InChIKey | UDLWTBCGOBJBGG-LLVKDONJSA-O |
| XLogP | 1.05 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|