C23H32N3O2+ — CID 9129569
[2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]azanium (PubChem CID 9129569) has the molecular formula C23H32N3O2+ and a molecular weight of 382.53 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]azanium.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 9129569 |
| Molecular Formula | C23H32N3O2+ |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1R)-1-(4-tert-butylphenyl)-2-methylpropyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+]CC(=O)NNC(=O)c1ccccc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-16(2)21(17-11-13-19(14-12-17)23(3,4)5)24-15-20(27)25-26-22(28)18-9-7-6-8-10-18/h6-14,16,21,24H,15H2,1-5H3,(H,25,27)(H,26,28)/p+1/t21-/m1/s1 |
| InChIKey | QOMBLJNZBAPYEJ-OAQYLSRUSA-O |
| XLogP | 2.71 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|