C17H28N3O2+ — CID 8923638
[2-(2-acetylhydrazinyl)-2-oxoethyl]-[(1R)-2-methyl-1-(4-propan-2-ylphenyl)propyl]azanium (PubChem CID 8923638) has the molecular formula C17H28N3O2+ and a molecular weight of 306.43 g/mol. Its IUPAC name is [2-(2-acetylhydrazinyl)-2-oxoethyl]-[(1R)-2-methyl-1-(4-propan-2-ylphenyl)propyl]azanium.
| Compound Name | [2-(2-acetylhydrazinyl)-2-oxoethyl]-[(1R)-2-methyl-1-(4-propan-2-ylphenyl)propyl]azanium |
|---|---|
| PubChem CID | 8923638 |
| Molecular Formula | C17H28N3O2+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | [2-(2-acetylhydrazinyl)-2-oxoethyl]-[(1R)-2-methyl-1-(4-propan-2-ylphenyl)propyl]azanium |
| SMILES | CC(=O)NNC(=O)C[NH2+][C@@H](c1ccc(C(C)C)cc1)C(C)C |
| InChI | InChI=1S/C17H27N3O2/c1-11(2)14-6-8-15(9-7-14)17(12(3)4)18-10-16(22)20-19-13(5)21/h6-9,11-12,17-18H,10H2,1-5H3,(H,19,21)(H,20,22)/p+1/t17-/m1/s1 |
| InChIKey | IMOJYCZDPFZJES-QGZVFWFLSA-O |
| XLogP | 1.24 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|