C20H32N3O2+ — CID 8995490
[2-(2-acetylhydrazinyl)-2-oxoethyl]-[(1R)-1-(4-cyclohexylphenyl)-2-methylpropyl]azanium (PubChem CID 8995490) has the molecular formula C20H32N3O2+ and a molecular weight of 346.50 g/mol. Its IUPAC name is [2-(2-acetylhydrazinyl)-2-oxoethyl]-[(1R)-1-(4-cyclohexylphenyl)-2-methylpropyl]azanium.
| Compound Name | [2-(2-acetylhydrazinyl)-2-oxoethyl]-[(1R)-1-(4-cyclohexylphenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 8995490 |
| Molecular Formula | C20H32N3O2+ |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [2-(2-acetylhydrazinyl)-2-oxoethyl]-[(1R)-1-(4-cyclohexylphenyl)-2-methylpropyl]azanium |
| SMILES | CC(=O)NNC(=O)C[NH2+][C@@H](c1ccc(C2CCCCC2)cc1)C(C)C |
| InChI | InChI=1S/C20H31N3O2/c1-14(2)20(21-13-19(25)23-22-15(3)24)18-11-9-17(10-12-18)16-7-5-4-6-8-16/h9-12,14,16,20-21H,4-8,13H2,1-3H3,(H,22,24)(H,23,25)/p+1/t20-/m1/s1 |
| InChIKey | KIAMQJNGLGBGNO-HXUWFJFHSA-O |
| XLogP | 2.16 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|