C19H31N2O+ — CID 8995475
[(2S)-1-amino-1-oxopropan-2-yl]-[(1R)-1-(4-cyclohexylphenyl)-2-methylpropyl]azanium (PubChem CID 8995475) has the molecular formula C19H31N2O+ and a molecular weight of 303.47 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl]-[(1R)-1-(4-cyclohexylphenyl)-2-methylpropyl]azanium.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl]-[(1R)-1-(4-cyclohexylphenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 8995475 |
| Molecular Formula | C19H31N2O+ |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl]-[(1R)-1-(4-cyclohexylphenyl)-2-methylpropyl]azanium |
| SMILES | CC(C)[C@@H]([NH2+][C@@H](C)C(N)=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H30N2O/c1-13(2)18(21-14(3)19(20)22)17-11-9-16(10-12-17)15-7-5-4-6-8-15/h9-15,18,21H,4-8H2,1-3H3,(H2,20,22)/p+1/t14-,18+/m0/s1 |
| InChIKey | WKGMJQKWNQBTJD-KBXCAEBGSA-O |
| XLogP | 2.87 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |