C17H20N3O2+ — CID 8897547
[2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1S)-1-phenylethyl]azanium (PubChem CID 8897547) has the molecular formula C17H20N3O2+ and a molecular weight of 298.37 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1S)-1-phenylethyl]azanium.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 8897547 |
| Molecular Formula | C17H20N3O2+ |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl]-[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NNC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c1-13(14-8-4-2-5-9-14)18-12-16(21)19-20-17(22)15-10-6-3-7-11-15/h2-11,13,18H,12H2,1H3,(H,19,21)(H,20,22)/p+1/t13-/m0/s1 |
| InChIKey | QHRPCONPEIKKSH-ZDUSSCGKSA-O |
| XLogP | 0.77 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|