C15H24N3O2+ — CID 8897926
[2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl]-[(1R)-1-phenylethyl]azanium (PubChem CID 8897926) has the molecular formula C15H24N3O2+ and a molecular weight of 278.38 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 8897926 |
| Molecular Formula | C15H24N3O2+ |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)C[NH2+][C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H23N3O2/c1-4-11(2)17-15(20)18-14(19)10-16-12(3)13-8-6-5-7-9-13/h5-9,11-12,16H,4,10H2,1-3H3,(H2,17,18,19,20)/p+1/t11-,12-/m1/s1 |
| InChIKey | ZELDZAONMKBSAM-VXGBXAGGSA-O |
| XLogP | 0.94 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |