C14H20N3O2+ — CID 8898048
[2-(cyclopropylcarbamoylamino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium (PubChem CID 8898048) has the molecular formula C14H20N3O2+ and a molecular weight of 262.33 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 8898048 |
| Molecular Formula | C14H20N3O2+ |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)NC(=O)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C14H19N3O2/c1-10(11-5-3-2-4-6-11)15-9-13(18)17-14(19)16-12-7-8-12/h2-6,10,12,15H,7-9H2,1H3,(H2,16,17,18,19)/p+1/t10-/m1/s1 |
| InChIKey | LHTOVIKWPBERMT-SNVBAGLBSA-O |
| XLogP | 0.30 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |